What is the molecular formula of Naphthol AS-LC?
The molecular formula of Naphthol AS-LC is C19H16ClNO4.
What is the molecular weight of Naphthol AS-LC?
The molecular weight of Naphthol AS-LC is 357.8 g/mol.
When was Naphthol AS-LC created?
Naphthol AS-LC was created on March 26, 2005.
When was Naphthol AS-LC last modified?
Naphthol AS-LC was last modified on December 23, 2023.
What is the IUPAC name of Naphthol AS-LC?
The IUPAC name of Naphthol AS-LC is N-(4-chloro-2,5-dimethoxyphenyl)-3-hydroxynaphthalene-2-carboxamide.
What is the InChI of Naphthol AS-LC?
The InChI of Naphthol AS-LC is InChI=1S/C19H16ClNO4/c1-24-17-10-15(18(25-2)9-14(17)20)21-19(23)13-7-11-5-3-4-6-12(11)8-16(13)22/h3-10,22H,1-2H3,(H,21,23).
What is the InChIKey of Naphthol AS-LC?
The InChIKey of Naphthol AS-LC is QIHKTBRNOLQDGQ-UHFFFAOYSA-N.
What is the canonical SMILES of Naphthol AS-LC?
The canonical SMILES of Naphthol AS-LC is COC1=CC(=C(C=C1NC(=O)C2=CC3=CC=CC=C3C=C2O)OC)Cl.
What is the CAS number of Naphthol AS-LC?
The CAS number of Naphthol AS-LC is 4273-92-1.
What is the XLogP3-AA value of Naphthol AS-LC?
The XLogP3-AA value of Naphthol AS-LC is 4.8.
How many hydrogen bond donor counts does Naphthol AS-LC have?
Naphthol AS-LC has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Naphthol AS-LC have?
Naphthol AS-LC has 4 hydrogen bond acceptor counts.