What is the molecular formula of Perfluorohexanesulfonamide?
The molecular formula of Perfluorohexanesulfonamide is C6F13SO2NH2C6H2F13NO2S.
What are the synonyms for Perfluorohexanesulfonamide?
The synonyms for Perfluorohexanesulfonamide include FHxSA, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide, and SODIUM PERFLUOROHEXANESULFONAMIDE.
What is the molecular weight of Perfluorohexanesulfonamide?
The molecular weight of Perfluorohexanesulfonamide is 399.13 g/mol.
When was Perfluorohexanesulfonamide created?
Perfluorohexanesulfonamide was created on October 26, 2006.
What is the IUPAC name of Perfluorohexanesulfonamide?
The IUPAC name of Perfluorohexanesulfonamide is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide.
What is the InChI of Perfluorohexanesulfonamide?
The InChI of Perfluorohexanesulfonamide is InChI=1S/C6H2F13NO2S/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22/h(H2,20,21,22).
What is the InChIKey of Perfluorohexanesulfonamide?
The InChIKey of Perfluorohexanesulfonamide is WDZLGCSJJWEQJO-UHFFFAOYSA-N.
What is the Canonical SMILES of Perfluorohexanesulfonamide?
The Canonical SMILES of Perfluorohexanesulfonamide is C(C(C(C(F)(F)S(=O)(=O)N)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F.
What is the CAS number of Perfluorohexanesulfonamide?
The CAS number of Perfluorohexanesulfonamide is 41997-13-1.
What is the XLogP3-AA value of Perfluorohexanesulfonamide?
The XLogP3-AA value of Perfluorohexanesulfonamide is 3.5.
Download
