What is the molecular formula of 3-Bromo-2-iodopyridine?
The molecular formula of 3-Bromo-2-iodopyridine is C5H3BrIN.
What is the molecular weight of 3-Bromo-2-iodopyridine?
The molecular weight of 3-Bromo-2-iodopyridine is 283.89 g/mol.
What is the IUPAC name of 3-Bromo-2-iodopyridine?
The IUPAC name of 3-Bromo-2-iodopyridine is 3-bromo-2-iodopyridine.
What is the InChI of 3-Bromo-2-iodopyridine?
The InChI of 3-Bromo-2-iodopyridine is InChI=1S/C5H3BrIN/c6-4-2-1-3-8-5(4)7/h1-3H.
What is the InChIKey of 3-Bromo-2-iodopyridine?
The InChIKey of 3-Bromo-2-iodopyridine is NYCGGAQICCWUCI-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-2-iodopyridine?
The canonical SMILES of 3-Bromo-2-iodopyridine is C1=CC(=C(N=C1)I)Br.
What is the CAS number of 3-Bromo-2-iodopyridine?
The CAS number of 3-Bromo-2-iodopyridine is 408502-43-2.
What is the molecular weight of 3-Bromo-2-iodopyridine according to PubChem?
The molecular weight of 3-Bromo-2-iodopyridine according to PubChem is 283.89 g/mol.
How many hydrogen bond donor counts does 3-Bromo-2-iodopyridine have?
3-Bromo-2-iodopyridine has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Bromo-2-iodopyridine have?
3-Bromo-2-iodopyridine has 1 hydrogen bond acceptor count.