What is the molecular formula of Methyl 4-fluorobenzoate?
The molecular formula of Methyl 4-fluorobenzoate is C8H7FO2.
What is the molecular weight of Methyl 4-fluorobenzoate?
The molecular weight of Methyl 4-fluorobenzoate is 154.14 g/mol.
What is the IUPAC name of Methyl 4-fluorobenzoate?
The IUPAC name of Methyl 4-fluorobenzoate is methyl 4-fluorobenzoate.
What is the InChI of Methyl 4-fluorobenzoate?
The InChI of Methyl 4-fluorobenzoate is InChI=1S/C8H7FO2/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5H,1H3.
What is the InChIKey of Methyl 4-fluorobenzoate?
The InChIKey of Methyl 4-fluorobenzoate is MSEBQGULDWDIRW-UHFFFAOYSA-N.
What is the CAS number of Methyl 4-fluorobenzoate?
The CAS number of Methyl 4-fluorobenzoate is 403-33-8.
What is the EC number of Methyl 4-fluorobenzoate?
The EC number of Methyl 4-fluorobenzoate is 206-956-7.
What is the XLogP3 value of Methyl 4-fluorobenzoate?
The XLogP3 value of Methyl 4-fluorobenzoate is 2.3.
What is the hydrogen bond donor count of Methyl 4-fluorobenzoate?
The hydrogen bond donor count of Methyl 4-fluorobenzoate is 0.
Is Methyl 4-fluorobenzoate a canonicalized compound?
Yes, Methyl 4-fluorobenzoate is a canonicalized compound.