What is the molecular formula of Fmoc-3-(2-quinolyl)-dl-ala-oh?
The molecular formula of Fmoc-3-(2-quinolyl)-dl-ala-oh is C27H22N2O4.
What are the synonyms of Fmoc-3-(2-quinolyl)-dl-ala-oh?
The synonyms of Fmoc-3-(2-quinolyl)-dl-ala-oh are 401514-70-3, Fmoc-3-(2-quinolyl)-DL-alanine, and Fmoc-3-(2-quinolyl)-DL-Ala-OH.
What is the molecular weight of Fmoc-3-(2-quinolyl)-dl-ala-oh?
The molecular weight of Fmoc-3-(2-quinolyl)-dl-ala-oh is 438.5 g/mol.
When was Fmoc-3-(2-quinolyl)-dl-ala-oh created?
Fmoc-3-(2-quinolyl)-dl-ala-oh was created on September 14, 2005.
When was Fmoc-3-(2-quinolyl)-dl-ala-oh last modified?
Fmoc-3-(2-quinolyl)-dl-ala-oh was last modified on October 21, 2023.
What is the IUPAC name of Fmoc-3-(2-quinolyl)-dl-ala-oh?
The IUPAC name of Fmoc-3-(2-quinolyl)-dl-ala-oh is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid.
What is the InChI of Fmoc-3-(2-quinolyl)-dl-ala-oh?
The InChI of Fmoc-3-(2-quinolyl)-dl-ala-oh is InChI=1S/C27H22N2O4/c30-26(31)25(15-18-14-13-17-7-1-6-12-24(17)28-18)29-27(32)33-16-23-21-10-4-2-8-19(21)20-9-3-5-11-22(20)23/h1-14,23,25H,15-16H2,(H,29,32)(H,30,31).
What is the InChIKey of Fmoc-3-(2-quinolyl)-dl-ala-oh?
The InChIKey of Fmoc-3-(2-quinolyl)-dl-ala-oh is IDOMHXAHHXHYMO-UHFFFAOYSA-N.
What is the canonical SMILES of Fmoc-3-(2-quinolyl)-dl-ala-oh?
The canonical SMILES of Fmoc-3-(2-quinolyl)-dl-ala-oh is C1=CC=C2C(=C1)C=CC(=N2)CC(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35.
What is the hydrogen bond donor count of Fmoc-3-(2-quinolyl)-dl-ala-oh?
The hydrogen bond donor count of Fmoc-3-(2-quinolyl)-dl-ala-oh is 2.
※ Please kindly note that our products are for research use only.