What is the molecular formula of 5-Phenyl-O-anisidine?
The molecular formula of 5-Phenyl-O-anisidine is C13H13NO.
What is the molecular weight of 5-Phenyl-O-anisidine?
The molecular weight of 5-Phenyl-O-anisidine is 199.25 g/mol.
What is the IUPAC name of 5-Phenyl-O-anisidine?
The IUPAC name of 5-Phenyl-O-anisidine is 2-methoxy-5-phenylaniline.
What is the InChI of 5-Phenyl-O-anisidine?
The InChI of 5-Phenyl-O-anisidine is InChI=1S/C13H13NO/c1-15-13-8-7-11(9-12(13)14)10-5-3-2-4-6-10/h2-9H,14H2,1H3.
What is the InChIKey of 5-Phenyl-O-anisidine?
The InChIKey of 5-Phenyl-O-anisidine is DTYBRSLINXBXMP-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Phenyl-O-anisidine?
The canonical SMILES of 5-Phenyl-O-anisidine is COC1=C(C=C(C=C1)C2=CC=CC=C2)N.
What is the CAS number of 5-Phenyl-O-anisidine?
The CAS number of 5-Phenyl-O-anisidine is 39811-17-1.
What is the European Community (EC) number of 5-Phenyl-O-anisidine?
The European Community (EC) number of 5-Phenyl-O-anisidine is 254-639-7.
What is the UNII of 5-Phenyl-O-anisidine?
The UNII of 5-Phenyl-O-anisidine is FLC6AV3B78.
Is 5-Phenyl-O-anisidine canonicalized?
Yes, 5-Phenyl-O-anisidine is canonicalized.