What is the molecular formula of 3-(Butylaminocarbonyl)phenylboronic acid?
The molecular formula of 3-(Butylaminocarbonyl)phenylboronic acid is C11H16BNO3.
What is the molecular weight of 3-(Butylaminocarbonyl)phenylboronic acid?
The molecular weight of 3-(Butylaminocarbonyl)phenylboronic acid is 221.06 g/mol.
What is the IUPAC name of 3-(Butylaminocarbonyl)phenylboronic acid?
The IUPAC name of 3-(Butylaminocarbonyl)phenylboronic acid is [3-(butylcarbamoyl)phenyl]boronic acid.
What is the InChI of 3-(Butylaminocarbonyl)phenylboronic acid?
The InChI of 3-(Butylaminocarbonyl)phenylboronic acid is InChI=1S/C11H16BNO3/c1-2-3-7-13-11(14)9-5-4-6-10(8-9)12(15)16/h4-6,8,15-16H,2-3,7H2,1H3,(H,13,14).
What is the InChIKey of 3-(Butylaminocarbonyl)phenylboronic acid?
The InChIKey of 3-(Butylaminocarbonyl)phenylboronic acid is UMTGJEHDHSYNMS-UHFFFAOYSA-N.
What is the canonical SMILES of 3-(Butylaminocarbonyl)phenylboronic acid?
The canonical SMILES of 3-(Butylaminocarbonyl)phenylboronic acid is B(C1=CC(=CC=C1)C(=O)NCCCC)(O)O.
What is the CAS number of 3-(Butylaminocarbonyl)phenylboronic acid?
The CAS number of 3-(Butylaminocarbonyl)phenylboronic acid is 397843-70-8.
What is the European Community (EC) number of 3-(Butylaminocarbonyl)phenylboronic acid?
The European Community (EC) number of 3-(Butylaminocarbonyl)phenylboronic acid is 813-451-0.
What is the DSSTox Substance ID of 3-(Butylaminocarbonyl)phenylboronic acid?
The DSSTox Substance ID of 3-(Butylaminocarbonyl)phenylboronic acid is DTXSID30395133.
Is 3-(Butylaminocarbonyl)phenylboronic acid a Canonicalized compound?
Yes, 3-(Butylaminocarbonyl)phenylboronic acid is a Canonicalized compound.
※ Please kindly note that our products are for research use only.