What is the molecular formula of 1,4-Dibromoadamantane?
The molecular formula of 1,4-Dibromoadamantane is C10H14Br2.
What is the molecular weight of 1,4-Dibromoadamantane?
The molecular weight of 1,4-Dibromoadamantane is 294.03 g/mol.
What is the IUPAC name of 1,4-Dibromoadamantane?
The IUPAC name of 1,4-Dibromoadamantane is 1,4-dibromoadamantane.
What is the InChI of 1,4-Dibromoadamantane?
The InChI of 1,4-Dibromoadamantane is InChI=1S/C10H14Br2/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7/h6-9H,1-5H2.
What is the InChIKey of 1,4-Dibromoadamantane?
The InChIKey of 1,4-Dibromoadamantane is BPJZBMGMBABTDL-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-Dibromoadamantane?
The canonical SMILES of 1,4-Dibromoadamantane is C1C2CC3CC(C2)(CC1C3Br)Br.
What is the CAS number of 1,4-Dibromoadamantane?
The CAS number of 1,4-Dibromoadamantane is 39646-72-5.
What is the XLogP3-AA value of 1,4-Dibromoadamantane?
The XLogP3-AA value of 1,4-Dibromoadamantane is 3.6.
How many hydrogen bond donor counts are there in 1,4-Dibromoadamantane?
There are 0 hydrogen bond donor counts in 1,4-Dibromoadamantane.
How many hydrogen bond acceptor counts are there in 1,4-Dibromoadamantane?
There are 0 hydrogen bond acceptor counts in 1,4-Dibromoadamantane.