What is the molecular formula of Hexafluorobenzene?
The molecular formula of Hexafluorobenzene is C6F6.
What is the molecular weight of Hexafluorobenzene?
The molecular weight of Hexafluorobenzene is 186.05 g/mol.
What is the IUPAC name of Hexafluorobenzene?
The IUPAC name of Hexafluorobenzene is 1,2,3,4,5,6-hexafluorobenzene.
What is the InChI of Hexafluorobenzene?
The InChI of Hexafluorobenzene is InChI=1S/C6F6/c7-1-2(8)4(10)6(12)5(11)3(1)9.
What is the InChIKey of Hexafluorobenzene?
The InChIKey of Hexafluorobenzene is ZQBFAOFFOQMSGJ-UHFFFAOYSA-N.
What are the synonyms of Hexafluorobenzene?
The synonyms of Hexafluorobenzene are HEXAFLUOROBENZENE, 392-56-3, Perfluorobenzene, 1,2,3,4,5,6-Hexafluorobenzene, and Benzene, hexafluoro-.
What is the CAS number of Hexafluorobenzene?
The CAS number of Hexafluorobenzene is 392-56-3.
How many hydrogen bond donor counts does Hexafluorobenzene have?
Hexafluorobenzene has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Hexafluorobenzene have?
Hexafluorobenzene has 6 hydrogen bond acceptor counts.