What is the molecular formula of 1,6-Dimethoxynaphthalene?
The molecular formula of 1,6-Dimethoxynaphthalene is C12H12O2.
What is the molecular weight of 1,6-Dimethoxynaphthalene?
The molecular weight of 1,6-Dimethoxynaphthalene is 188.22 g/mol.
What is the IUPAC name of 1,6-Dimethoxynaphthalene?
The IUPAC name of 1,6-Dimethoxynaphthalene is 1,6-dimethoxynaphthalene.
What is the InChI of 1,6-Dimethoxynaphthalene?
The InChI of 1,6-Dimethoxynaphthalene is InChI=1S/C12H12O2/c1-13-10-6-7-11-9(8-10)4-3-5-12(11)14-2/h3-8H,1-2H3.
What is the InChIKey of 1,6-Dimethoxynaphthalene?
The InChIKey of 1,6-Dimethoxynaphthalene is RBUFUWIWCCOVOS-UHFFFAOYSA-N.
What is the canonical SMILES of 1,6-Dimethoxynaphthalene?
The canonical SMILES of 1,6-Dimethoxynaphthalene is COC1=CC2=C(C=C1)C(=CC=C2)OC.
What is the CAS number of 1,6-Dimethoxynaphthalene?
The CAS number of 1,6-Dimethoxynaphthalene is 3900-49-0.
What is the EC number of 1,6-Dimethoxynaphthalene?
The EC number of 1,6-Dimethoxynaphthalene is 625-845-8.
What is the XLogP3 value of 1,6-Dimethoxynaphthalene?
The XLogP3 value of 1,6-Dimethoxynaphthalene is 3.6.
Is 1,6-Dimethoxynaphthalene a canonicalized compound?
Yes, 1,6-Dimethoxynaphthalene is a canonicalized compound.