What is the molecular formula of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid?
The molecular formula of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid is C14H12BNO6.
What is the IUPAC name of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid?
The IUPAC name of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid is (3-nitro-5-phenylmethoxycarbonylphenyl)boronic acid.
What is the InChI of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid?
The InChI of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid is InChI=1S/C14H12BNO6/c17-14(22-9-10-4-2-1-3-5-10)11-6-12(15(18)19)8-13(7-11)16(20)21/h1-8,18-19H,9H2.
What is the InChIKey of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid?
The InChIKey of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid is YDPDKQXYZBUILB-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid?
The canonical SMILES of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid is B(C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)OCC2=CC=CC=C2)(O)O.
What is the CAS number of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid?
The CAS number of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid is 380430-62-6.
What is the molecular weight of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid?
The molecular weight of 3-Benzyloxycarbonyl-5-nitrophenylboronic acid is 301.06 g/mol.
How many hydrogen bond donor atoms are there in 3-Benzyloxycarbonyl-5-nitrophenylboronic acid?
There are 2 hydrogen bond donor atoms in 3-Benzyloxycarbonyl-5-nitrophenylboronic acid.
How many hydrogen bond acceptor atoms are there in 3-Benzyloxycarbonyl-5-nitrophenylboronic acid?
There are 6 hydrogen bond acceptor atoms in 3-Benzyloxycarbonyl-5-nitrophenylboronic acid.
How many rotatable bonds are there in 3-Benzyloxycarbonyl-5-nitrophenylboronic acid?
There are 5 rotatable bonds in 3-Benzyloxycarbonyl-5-nitrophenylboronic acid.
※ Please kindly note that our products are for research use only.