What is the molecular formula of 4-Amino-3-bromoquinoline?
The molecular formula of 4-Amino-3-bromoquinoline is C9H7BrN2.
What is the molecular weight of 4-Amino-3-bromoquinoline?
The molecular weight of 4-Amino-3-bromoquinoline is 223.07 g/mol.
When was 4-Amino-3-bromoquinoline created?
4-Amino-3-bromoquinoline was created on July 8, 2005.
When was 4-Amino-3-bromoquinoline last modified?
4-Amino-3-bromoquinoline was last modified on December 2, 2023.
What is the IUPAC name of 4-Amino-3-bromoquinoline?
The IUPAC name of 4-Amino-3-bromoquinoline is 3-bromoquinolin-4-amine.
What is the InChI code of 4-Amino-3-bromoquinoline?
The InChI code of 4-Amino-3-bromoquinoline is InChI=1S/C9H7BrN2/c10-7-5-12-8-4-2-1-3-6(8)9(7)11/h1-5H,(H2,11,12).
What is the InChIKey of 4-Amino-3-bromoquinoline?
The InChIKey of 4-Amino-3-bromoquinoline is TYGUEEGQSYNEHB-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Amino-3-bromoquinoline?
The canonical SMILES of 4-Amino-3-bromoquinoline is C1=CC=C2C(=C1)C(=C(C=N2)Br)N.
What is the CAS number of 4-Amino-3-bromoquinoline?
The CAS number of 4-Amino-3-bromoquinoline is 36825-36-2.
What is the hydrogen bond donor count of 4-Amino-3-bromoquinoline?
The hydrogen bond donor count of 4-Amino-3-bromoquinoline is 1.