What is the molecular formula of Astrazon Pink FG?
The molecular formula of Astrazon Pink FG is C22H26Cl2N2.
What is the molecular weight of Astrazon Pink FG?
The molecular weight of Astrazon Pink FG is 389.4 g/mol.
What is the IUPAC name of Astrazon Pink FG?
The IUPAC name of Astrazon Pink FG is N-(2-chloroethyl)-N-methyl-4-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline;chloride.
What is the InChIKey of Astrazon Pink FG?
The InChIKey of Astrazon Pink FG is ZTBANYZVKCGOKD-UHFFFAOYSA-M.
What is the CAS number of Astrazon Pink FG?
The CAS number of Astrazon Pink FG is 3648-36-0.
What is the hydrogen bond donor count of Astrazon Pink FG?
Astrazon Pink FG has a hydrogen bond donor count of 0.
How many rotatable bonds does Astrazon Pink FG have?
Astrazon Pink FG has 5 rotatable bonds.
What is the exact mass of Astrazon Pink FG?
The exact mass of Astrazon Pink FG is 388.1473042 g/mol.
What is the topological polar surface area of Astrazon Pink FG?
The topological polar surface area of Astrazon Pink FG is 6.2?2.
How many heavy atoms are present in Astrazon Pink FG?
Astrazon Pink FG has 26 heavy atoms.
What is the InChI of Astrazon Pink FG?
The InChI of Astrazon Pink FG is InChI=1S/C22H26ClN2.ClH/c1-22(2)19-7-5-6-8-20(19)25(4)21(22)14-11-17-9-12-18(13-10-17)24(3)16-15-23;/h5-14H,15-16H2,1-4H3;1H/q+1;/p-1.
How many hydrogen bond donor counts does Astrazon Pink FG have?
Astrazon Pink FG has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Astrazon Pink FG have?
Astrazon Pink FG has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does Astrazon Pink FG have?
Astrazon Pink FG has 5 rotatable bond counts.