The molecular formula of the compound is C16H9BrINO2.
What are the synonyms for the compound?
The synonyms for the compound are: 6-bromo-2-(4-iodophenyl)quinoline-4-carboxylic acid 364383-14-2 6-Bromo-2-(4-iodophenyl)quinoline-4-carboxylic acid 6-Bromo-2-(4-iodo-phenyl)-quinoline-4-carboxylic acid 6-bromo-2-(4-iodo-phenyl)quinoline-4-carboxylic acid
What is the molecular weight of the compound?
The molecular weight of the compound is 454.06 g/mol.
When was the compound created?
The compound was created on July 19, 2005.
When was the compound last modified?
The compound was last modified on December 02, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 6-bromo-2-(4-iodophenyl)quinoline-4-carboxylic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C16H9BrINO2/c17-10-3-6-14-12(7-10)13(16(20)21)8-15(19-14)9-1-4-11(18)5-2-9/h1-8H,(H,20,21).
What is the InChIKey of the compound?
The InChIKey of the compound is VNMAGEIUPNSPSY-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC=C1C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)O).
What is the CAS number of the compound?
The CAS number of the compound is 364383-14-2.
※ Please kindly note that our products are for research use only.