What is the molecular formula of phenylmaleic anhydride?
The molecular formula of phenylmaleic anhydride is C10H6O3.
What is the molecular weight of phenylmaleic anhydride?
The molecular weight of phenylmaleic anhydride is 174.15 g/mol.
What is the IUPAC name of phenylmaleic anhydride?
The IUPAC name of phenylmaleic anhydride is 3-phenylfuran-2,5-dione.
What is the InChI of phenylmaleic anhydride?
The InChI of phenylmaleic anhydride is InChI=1S/C10H6O3/c11-9-6-8(10(12)13-9)7-4-2-1-3-5-7/h1-6H.
What is the InChIKey of phenylmaleic anhydride?
The InChIKey of phenylmaleic anhydride is QZYCWJVSPFQUQC-UHFFFAOYSA-N.
What is the canonical SMILES of phenylmaleic anhydride?
The canonical SMILES of phenylmaleic anhydride is C1=CC=C(C=C1)C2=CC(=O)OC2=O.
What is the CAS number of phenylmaleic anhydride?
The CAS number of phenylmaleic anhydride is 36122-35-7.
What is the European Community (EC) number of phenylmaleic anhydride?
The European Community (EC) number of phenylmaleic anhydride is 252-881-8.
What is the UNII of phenylmaleic anhydride?
The UNII of phenylmaleic anhydride is 4UE4F66S87.