What is the molecular formula of 1,4-Phenylenediacryloyl chloride?
The molecular formula is C12H8Cl2O2.
What is the PubChem CID of 1,4-Phenylenediacryloyl chloride?
The PubChem CID is 5989690.
What are the synonyms for 1,4-Phenylenediacryloyl chloride?
The synonyms are 1,4-Phenylenediacryloyl chloride, 35288-49-4, 3,3'-(1,4-Phenylene)diacryloyl chloride, (E)-3-[4-[(E)-3-chloro-3-oxoprop-1-enyl]phenyl]prop-2-enoyl chloride, and 3-[4-(3-CHLORO-3-OXOPROP-1-EN-1-YL)PHENYL]PROP-2-ENOYL CHLORIDE.
What is the molecular weight of 1,4-Phenylenediacryloyl chloride?
The molecular weight is 255.09 g/mol.
When was 1,4-Phenylenediacryloyl chloride created and last modified?
It was created on September 13, 2005, and last modified on December 2, 2023.
What is the IUPAC name of 1,4-Phenylenediacryloyl chloride?
The IUPAC name is (E)-3-[4-[(E)-3-chloro-3-oxoprop-1-enyl]phenyl]prop-2-enoyl chloride.
What is the InChI of 1,4-Phenylenediacryloyl chloride?
The InChI is InChI=1S/C12H8Cl2O2/c13-11(15)7-5-9-1-2-10(4-3-9)6-8-12(14)16/h1-8H/b7-5+,8-6+.
What is the InChIKey of 1,4-Phenylenediacryloyl chloride?
The InChIKey is WQZLRZFBCIUDFL-KQQUZDAGSA-N.
What is the canonical SMILES of 1,4-Phenylenediacryloyl chloride?
The canonical SMILES is C1=CC(=CC=C1C=CC(=O)Cl)C=CC(=O)Cl.
What is the CAS number of 1,4-Phenylenediacryloyl chloride?
The CAS number is 35288-49-4.
※ Please kindly note that our products are for research use only.