What is the PubChem CID of N-Vinylphthalimide?
The PubChem CID of N-Vinylphthalimide is 77035.
What is the molecular formula of N-Vinylphthalimide?
The molecular formula of N-Vinylphthalimide is C10H7NO2.
What is the molecular weight of N-Vinylphthalimide?
The molecular weight of N-Vinylphthalimide is 173.17 g/mol.
What is the IUPAC name of N-Vinylphthalimide?
The IUPAC name of N-Vinylphthalimide is 2-ethenylisoindole-1,3-dione.
What are the synonyms of N-Vinylphthalimide?
The synonyms of N-Vinylphthalimide are 2-Vinylisoindoline-1,3-dione and Phthalimide, N-vinyl.
What is the InChI of N-Vinylphthalimide?
The InChI of N-Vinylphthalimide is InChI=1S/C10H7NO2/c1-2-11-9(12)7-5-3-4-6-8(7)10(11)13/h2-6H,1H2.
What is the Canonical SMILES of N-Vinylphthalimide?
The Canonical SMILES of N-Vinylphthalimide is C=CN1C(=O)C2=CC=CC=C2C1=O.
What is the CAS number of N-Vinylphthalimide?
The CAS number of N-Vinylphthalimide is 3485-84-5.
What is the European Community (EC) number of N-Vinylphthalimide?
The European Community (EC) number of N-Vinylphthalimide is 222-473-4.
Is N-Vinylphthalimide a canonicalized compound?
Yes, N-Vinylphthalimide is a canonicalized compound.