What is the PubChem CID for 2-Bromobenzaldoxime?
The PubChem CID for 2-Bromobenzaldoxime is 6876022.
What is the molecular formula of 2-Bromobenzaldoxime?
The molecular formula of 2-Bromobenzaldoxime is C7H6BrNO.
What is the molecular weight of 2-Bromobenzaldoxime?
The molecular weight of 2-Bromobenzaldoxime is 200.03 g/mol.
What is the IUPAC name of 2-Bromobenzaldoxime?
The IUPAC name of 2-Bromobenzaldoxime is (NE)-N-[(2-bromophenyl)methylidene]hydroxylamine.
What is the InChI of 2-Bromobenzaldoxime?
The InChI of 2-Bromobenzaldoxime is InChI=1S/C7H6BrNO/c8-7-4-2-1-3-6(7)5-9-10/h1-5,10H/b9-5+.
What is the InChIKey of 2-Bromobenzaldoxime?
The InChIKey of 2-Bromobenzaldoxime is PSIRFUPZHPEKAE-WEVVVXLNSA-N.
What is the canonical SMILES of 2-Bromobenzaldoxime?
The canonical SMILES of 2-Bromobenzaldoxime is C1=CC=C(C(=C1)C=NO)Br.
How many hydrogen bond donor counts does 2-Bromobenzaldoxime have?
2-Bromobenzaldoxime has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Bromobenzaldoxime have?
2-Bromobenzaldoxime has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Bromobenzaldoxime have?
2-Bromobenzaldoxime has 1 rotatable bond count.
Download
![3-Bromo-1H-pyrazolo[4,3-c]pyridine](https://resource.alfa-chemistry.com/structure/633328-88-8.gif)
