What is the molecular formula of 6-Chloro-5-Hydroxypyridine-2-carboxylic acid?
The molecular formula is C6H4ClNO3.
What are the synonyms for 6-Chloro-5-Hydroxypyridine-2-carboxylic acid?
The synonyms include 341008-96-6, 6-Chloro-5-hydroxypicolinic acid, 6-Chloro-5-hydroxy-pyridine-2-carboxylic acid, and 2-PYRIDINECARBOXYLIC ACID, 6-CHLORO-5-HYDROXY-.
What is the molecular weight of 6-Chloro-5-Hydroxypyridine-2-carboxylic acid?
The molecular weight is 173.55 g/mol.
When was 6-Chloro-5-Hydroxypyridine-2-carboxylic acid created?
It was created on February 7, 2007.
What is the IUPAC name of 6-Chloro-5-Hydroxypyridine-2-carboxylic acid?
The IUPAC name is 6-chloro-5-hydroxypyridine-2-carboxylic acid.
What is the InChI of 6-Chloro-5-Hydroxypyridine-2-carboxylic acid?
The InChI is InChI=1S/C6H4ClNO3/c7-5-4(9)2-1-3(8-5)6(10)11/h1-2,9H,(H,10,11).
What is the InChIKey of 6-Chloro-5-Hydroxypyridine-2-carboxylic acid?
The InChIKey is XDUHZKSABRITIB-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Chloro-5-Hydroxypyridine-2-carboxylic acid?
The canonical SMILES is C1=CC(=NC(=C1O)Cl)C(=O)O.
What is the CAS number of 6-Chloro-5-Hydroxypyridine-2-carboxylic acid?
The CAS number is 341008-96-6.
What is the XLogP3-AA value of 6-Chloro-5-Hydroxypyridine-2-carboxylic acid?
The XLogP3-AA value is 1.3.
※ Please kindly note that our products are for research use only.