What is the molecular formula of N-Methyldipropylamine?
The molecular formula of N-Methyldipropylamine is C7H17N.
What is the molecular weight of N-Methyldipropylamine?
The molecular weight of N-Methyldipropylamine is 115.22 g/mol.
What is the IUPAC name of N-Methyldipropylamine?
The IUPAC name of N-Methyldipropylamine is N-methyl-N-propylpropan-1-amine.
What is the InChI of N-Methyldipropylamine?
The InChI of N-Methyldipropylamine is InChI=1S/C7H17N/c1-4-6-8(3)7-5-2/h4-7H2,1-3H3.
What is the InChIKey of N-Methyldipropylamine?
The InChIKey of N-Methyldipropylamine is UVBMZKBIZUWTLV-UHFFFAOYSA-N.
What is the canonical SMILES of N-Methyldipropylamine?
The canonical SMILES of N-Methyldipropylamine is CCCN(C)CCC.
What is the CAS number of N-Methyldipropylamine?
The CAS number of N-Methyldipropylamine is 3405-42-3.
What is the EC number of N-Methyldipropylamine?
The EC number of N-Methyldipropylamine is 625-004-5.
What is the hydrogen bond donor count of N-Methyldipropylamine?
The hydrogen bond donor count of N-Methyldipropylamine is 0.
Is N-Methyldipropylamine a canonicalized compound?
Yes, N-Methyldipropylamine is a canonicalized compound.