What is the molecular formula of 1-Bromo-2-naphthaldehyde?
The molecular formula of 1-Bromo-2-naphthaldehyde is C11H7BrO.
What is the molecular weight of 1-Bromo-2-naphthaldehyde?
The molecular weight of 1-Bromo-2-naphthaldehyde is 235.08 g/mol.
What is the IUPAC name of 1-Bromo-2-naphthaldehyde?
The IUPAC name of 1-Bromo-2-naphthaldehyde is 1-bromonaphthalene-2-carbaldehyde.
What is the InChI of 1-Bromo-2-naphthaldehyde?
The InChI of 1-Bromo-2-naphthaldehyde is InChI=1S/C11H7BrO/c12-11-9(7-13)6-5-8-3-1-2-4-10(8)11/h1-7H.
What is the InChIKey of 1-Bromo-2-naphthaldehyde?
The InChIKey of 1-Bromo-2-naphthaldehyde is CYGUXEZVBLMVRV-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Bromo-2-naphthaldehyde?
The canonical SMILES of 1-Bromo-2-naphthaldehyde is C1=CC=C2C(=C1)C=CC(=C2Br)C=O.
What is the CAS number of 1-Bromo-2-naphthaldehyde?
The CAS number of 1-Bromo-2-naphthaldehyde is 3378-82-3.
How many hydrogen bond donor counts does 1-Bromo-2-naphthaldehyde have?
1-Bromo-2-naphthaldehyde has 0 hydrogen bond donor counts.
What is the topological polar surface area of 1-Bromo-2-naphthaldehyde?
The topological polar surface area of 1-Bromo-2-naphthaldehyde is 17.1Ų.
Is 1-Bromo-2-naphthaldehyde a canonicalized compound?
Yes, 1-Bromo-2-naphthaldehyde is a canonicalized compound.
Download
![Dibenz[a,c]anthracene](https://resource.alfa-chemistry.com/structure/215-58-7.gif)
