What is the molecular formula of 4-Benzyloxy-3,5-dimethylphenylboronic acid?
The molecular formula of 4-Benzyloxy-3,5-dimethylphenylboronic acid is C15H17BO3.
What is the molecular weight of 4-Benzyloxy-3,5-dimethylphenylboronic acid?
The molecular weight of 4-Benzyloxy-3,5-dimethylphenylboronic acid is 256.11 g/mol.
When was 4-Benzyloxy-3,5-dimethylphenylboronic acid created?
4-Benzyloxy-3,5-dimethylphenylboronic acid was created on September 13, 2005.
When was 4-Benzyloxy-3,5-dimethylphenylboronic acid last modified?
4-Benzyloxy-3,5-dimethylphenylboronic acid was last modified on December 2, 2023.
What is the IUPAC Name of 4-Benzyloxy-3,5-dimethylphenylboronic acid?
The IUPAC Name of 4-Benzyloxy-3,5-dimethylphenylboronic acid is (3,5-dimethyl-4-phenylmethoxyphenyl)boronic acid.
What is the InChI of 4-Benzyloxy-3,5-dimethylphenylboronic acid?
The InChI of 4-Benzyloxy-3,5-dimethylphenylboronic acid is InChI=1S/C15H17BO3/c1-11-8-14(16(17)18)9-12(2)15(11)19-10-13-6-4-3-5-7-13/h3-9,17-18H,10H2,1-2H3.
What is the InChIKey of 4-Benzyloxy-3,5-dimethylphenylboronic acid?
The InChIKey of 4-Benzyloxy-3,5-dimethylphenylboronic acid is CJTSQFDAXDNKNQ-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Benzyloxy-3,5-dimethylphenylboronic acid?
The Canonical SMILES of 4-Benzyloxy-3,5-dimethylphenylboronic acid is B(C1=CC(=C(C(=C1)C)OCC2=CC=CC=C2)C)(O)O.
What is the CAS number of 4-Benzyloxy-3,5-dimethylphenylboronic acid?
The CAS number of 4-Benzyloxy-3,5-dimethylphenylboronic acid is 333788-94-6.
Is 4-Benzyloxy-3,5-dimethylphenylboronic acid a canonicalized compound?
Yes, 4-Benzyloxy-3,5-dimethylphenylboronic acid is a canonicalized compound.
※ Please kindly note that our products are for research use only.