What is the molecular formula of (R)-4-Chloromandelic acid?
The molecular formula of (R)-4-Chloromandelic acid is C8H7ClO3.
What is the synonyms for (R)-4-Chloromandelic acid?
The synonyms for (R)-4-Chloromandelic acid include 32189-36-9, (R)-2-(4-Chlorophenyl)-2-hydroxyacetic acid, (2R)-2-(4-chlorophenyl)-2-hydroxyacetic acid, and (R)-2-(4-Chlorophenyl)-2-hydroxyethanoic acid.
What is the molecular weight of (R)-4-Chloromandelic acid?
The molecular weight of (R)-4-Chloromandelic acid is 186.59 g/mol.
What is the IUPAC name of (R)-4-Chloromandelic acid?
The IUPAC name of (R)-4-Chloromandelic acid is (2R)-2-(4-chlorophenyl)-2-hydroxyacetic acid.
What is the InChI of (R)-4-Chloromandelic acid?
The InChI of (R)-4-Chloromandelic acid is InChI=1S/C8H7ClO3/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,10H,(H,11,12)/t7-/m1/s1.
What is the InChIKey of (R)-4-Chloromandelic acid?
The InChIKey of (R)-4-Chloromandelic acid is BWSFWXSSALIZAU-SSDOTTSWSA-N.
What is the canonical SMILES of (R)-4-Chloromandelic acid?
The canonical SMILES of (R)-4-Chloromandelic acid is C1=CC(=CC=C1C(C(=O)O)O)Cl.
How many hydrogen bond donor count does (R)-4-Chloromandelic acid have?
(R)-4-Chloromandelic acid has 2 hydrogen bond donor count.
What is the topological polar surface area of (R)-4-Chloromandelic acid?
The topological polar surface area of (R)-4-Chloromandelic acid is 57.5Ų.
Is (R)-4-Chloromandelic acid considered as a canonicalized compound?
Yes, (R)-4-Chloromandelic acid is considered as a canonicalized compound.
※ Please kindly note that our products are for research use only.