In the experiment, 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl can catalyze the efficient epoxidation of olefins.
What is the molecular formula of 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl?
The molecular formula is C45H28N4ORh.
What is the molecular weight of 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl?
The molecular weight is 743.6 g/mol.
What is the IUPAC name of 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl?
The IUPAC name is carbon monoxide;rhodium(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide.
What is the InChI of 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl?
The InChI is InChI=1S/C44H28N4.CO.Rh/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;1-2;/h1-28H;;/q-2;;+2.
What is the Canonical SMILES of 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl?
The Canonical SMILES is [C-]#[O+].C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.[Rh+2].
What is the CAS number of 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl?
The CAS number is 32073-84-0.
What is the EC number of 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl?
The EC number is 620-639-4.
What is the hydrogen bond donor count of 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl?
The hydrogen bond acceptor count is 5.
What is the rotatable bond count of 5,10,15,20-Tetraphenyl-21H,23H-porphine ruthenium(II) carbonyl?
The rotatable bond count is 4.
※ Please kindly note that our products are for research use only.