What is the molecular formula of cinnamyl methacrylate?
The molecular formula of cinnamyl methacrylate is C13H14O2.
What is the molecular weight of cinnamyl methacrylate?
The molecular weight of cinnamyl methacrylate is 202.25 g/mol.
What is the IUPAC name of cinnamyl methacrylate?
The IUPAC name of cinnamyl methacrylate is [(E)-3-phenylprop-2-enyl] 2-methylprop-2-enoate.
What is the InChI of cinnamyl methacrylate?
The InChI of cinnamyl methacrylate is InChI=1S/C13H14O2/c1-11(2)13(14)15-10-6-9-12-7-4-3-5-8-12/h3-9H,1,10H2,2H3/b9-6+.
What is the InChIKey of cinnamyl methacrylate?
The InChIKey of cinnamyl methacrylate is QJAIDMRTITZOLC-RMKNXTFCSA-N.
What is the canonical SMILES representation of cinnamyl methacrylate?
The canonical SMILES representation of cinnamyl methacrylate is CC(=C)C(=O)OCC=CC1=CC=CC=C1.
What are the synonyms of cinnamyl methacrylate?
The synonyms of cinnamyl methacrylate include CINNAMYL METHACRYLATE, 31736-34-2, (2E)-3-phenylprop-2-en-1-yl 2-methylprop-2-enoate, NSC20976, SCHEMBL75625.
What is the XLogP3-AA value of cinnamyl methacrylate?
The XLogP3-AA value of cinnamyl methacrylate is 3.2.
What is the hydrogen bond donor count of cinnamyl methacrylate?
The hydrogen bond donor count of cinnamyl methacrylate is 0.
Is cinnamyl methacrylate a canonically represented compound?
Yes, cinnamyl methacrylate is a canonically represented compound.
Download
