What is the molecular formula of 8-nonylenic acid?
The molecular formula of 8-nonylenic acid is C9H16O2.
What is the molecular weight of 8-nonylenic acid?
The molecular weight of 8-nonylenic acid is 156.22 g/mol.
What is the IUPAC name of 8-nonylenic acid?
The IUPAC name of 8-nonylenic acid is non-8-enoic acid.
What is the InChI of 8-nonylenic acid?
The InChI of 8-nonylenic acid is InChI=1S/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h2H,1,3-8H2,(H,10,11).
What is the InChIKey of 8-nonylenic acid?
The InChIKey of 8-nonylenic acid is AWQOXJOAQMCOED-UHFFFAOYSA-N.
What is the canonical SMILES of 8-nonylenic acid?
The canonical SMILES of 8-nonylenic acid is C=CCCCCCCC(=O)O.
What is the CAS number of 8-nonylenic acid?
The CAS number of 8-nonylenic acid is 31642-67-8.
What is the EC number of 8-nonylenic acid?
The EC number of 8-nonylenic acid is 686-918-8.
What is the UNII of 8-nonylenic acid?
The UNII of 8-nonylenic acid is 0QA4Y5MV0O.
Is 8-nonylenic acid a canonicalized compound?
Yes, 8-nonylenic acid is a canonicalized compound.