What is the molecular formula of Tetrathiafulvalene?
The molecular formula of Tetrathiafulvalene is C6H4S4.
What is the molecular weight of Tetrathiafulvalene?
The molecular weight of Tetrathiafulvalene is 204.4 g/mol.
What is the IUPAC name of Tetrathiafulvalene?
The IUPAC name of Tetrathiafulvalene is 2-(1,3-dithiol-2-ylidene)-1,3-dithiole.
What is the InChI code of Tetrathiafulvalene?
The InChI code of Tetrathiafulvalene is InChI=1S/C6H4S4/c1-2-8-5(7-1)6-9-3-4-10-6/h1-4H.
What is the InChIKey of Tetrathiafulvalene?
The InChIKey of Tetrathiafulvalene is FHCPAXDKURNIOZ-UHFFFAOYSA-N.
What is the canonical SMILES of Tetrathiafulvalene?
The canonical SMILES of Tetrathiafulvalene is C1=CSC(=C2SC=CS2)S1.
What is the CAS number of Tetrathiafulvalene?
The CAS number of Tetrathiafulvalene is 31366-25-3.
What is the molecular weight of Tetrathiafulvalene according to PubChem?
The molecular weight of Tetrathiafulvalene according to PubChem is 204.4 g/mol.
How many hydrogen bond donor counts does Tetrathiafulvalene have?
Tetrathiafulvalene has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Tetrathiafulvalene have?
Tetrathiafulvalene has 4 hydrogen bond acceptor counts.