What is the molecular formula of BASIC ORANGE 21?
The molecular formula of BASIC ORANGE 21 is C22H23ClN2.
What is the molecular weight of BASIC ORANGE 21?
The molecular weight of BASIC ORANGE 21 is 350.9 g/mol.
What is the IUPAC name of BASIC ORANGE 21?
The IUPAC name of BASIC ORANGE 21 is 1,3,3-trimethyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)ethenyl]indol-1-ium;chloride.
What is the InChIKey of BASIC ORANGE 21?
The InChIKey of BASIC ORANGE 21 is ZOMLUNRKXJYKPD-UHFFFAOYSA-N.
What is the canonical SMILES of BASIC ORANGE 21?
The canonical SMILES of BASIC ORANGE 21 is CC1=C(C2=CC=CC=C2N1)C=CC3=[N+](C4=CC=CC=C4C3(C)C).[Cl-].
What is the CAS number of BASIC ORANGE 21?
The CAS number of BASIC ORANGE 21 is 3056-93-7.
What is the hydrogen bond donor count of BASIC ORANGE 21?
The hydrogen bond donor count of BASIC ORANGE 21 is 1.
What is the hydrogen bond acceptor count of BASIC ORANGE 21?
The hydrogen bond acceptor count of BASIC ORANGE 21 is 1.
What is the rotatable bond count of BASIC ORANGE 21?
The rotatable bond count of BASIC ORANGE 21 is 2.
What is the topological polar surface area of BASIC ORANGE 21?
The topological polar surface area of BASIC ORANGE 21 is 18.8?2.
What is the InChI of Basic Orange 21?
The InChI of Basic Orange 21 is InChI=1S/C22H22N2.ClH/c1-15-16(17-9-5-7-11-19(17)23-15)13-14-21-22(2,3)18-10-6-8-12-20(18)24(21)4;/h5-14H,1-4H3;1H.
How many hydrogen bond donor counts does Basic Orange 21 have?
Basic Orange 21 has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Basic Orange 21 have?
Basic Orange 21 has 1 hydrogen bond acceptor count.
How many rotatable bond counts does Basic Orange 21 have?
Basic Orange 21 has 2 rotatable bond counts.