What is the molecular formula of 1-Pyrenecarboxaldehyde?
The molecular formula of 1-Pyrenecarboxaldehyde is C17H10O.
What is the molecular weight of 1-Pyrenecarboxaldehyde?
The molecular weight of 1-Pyrenecarboxaldehyde is 230.26 g/mol.
What is the IUPAC name of 1-Pyrenecarboxaldehyde?
The IUPAC name of 1-Pyrenecarboxaldehyde is pyrene-1-carbaldehyde.
What is the InChI of 1-Pyrenecarboxaldehyde?
The InChI of 1-Pyrenecarboxaldehyde is "InChI=1S/C17H10O/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-10H".
What is the InChIKey of 1-Pyrenecarboxaldehyde?
The InChIKey of 1-Pyrenecarboxaldehyde is "RCYFOPUXRMOLQM-UHFFFAOYSA-N".
What is the canonical SMILES of 1-Pyrenecarboxaldehyde?
The canonical SMILES of 1-Pyrenecarboxaldehyde is "C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C=O".
What is the CAS number of 1-Pyrenecarboxaldehyde?
The CAS number of 1-Pyrenecarboxaldehyde is 3029-19-4.
What is the European Community (EC) number of 1-Pyrenecarboxaldehyde?
The European Community (EC) number of 1-Pyrenecarboxaldehyde is 221-196-6.
What is the UNII of 1-Pyrenecarboxaldehyde?
The UNII of 1-Pyrenecarboxaldehyde is I9H95PVI1P.
Is 1-Pyrenecarboxaldehyde a canonicalized compound?
Yes, 1-Pyrenecarboxaldehyde is a canonicalized compound.