What is the molecular formula of 2-Bromoisonicotinamide?
The molecular formula of 2-Bromoisonicotinamide is C6H5BrN2O.
What is the molecular weight of 2-Bromoisonicotinamide?
The molecular weight of 2-Bromoisonicotinamide is 201.02 g/mol.
What is the IUPAC name of 2-Bromoisonicotinamide?
The IUPAC name of 2-Bromoisonicotinamide is 2-bromopyridine-4-carboxamide.
What is the InChI of 2-Bromoisonicotinamide?
The InChI of 2-Bromoisonicotinamide is InChI=1S/C6H5BrN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10).
What is the InChIKey of 2-Bromoisonicotinamide?
The InChIKey of 2-Bromoisonicotinamide is KCELTDZFDHPTBI-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromoisonicotinamide?
The canonical SMILES of 2-Bromoisonicotinamide is C1=CN=C(C=C1C(=O)N)Br.
What is the CAS number of 2-Bromoisonicotinamide?
The CAS number of 2-Bromoisonicotinamide is 29840-73-1.
What is the XLogP3 value of 2-Bromoisonicotinamide?
The XLogP3 value of 2-Bromoisonicotinamide is 0.6.
How many hydrogen bond donor counts does 2-Bromoisonicotinamide have?
2-Bromoisonicotinamide has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Bromoisonicotinamide have?
2-Bromoisonicotinamide has 2 hydrogen bond acceptor counts.