What is the molecular formula of the compound?
The molecular formula of the compound is C19H23NO.
What are the synonyms of the compound?
The synonyms of the compound include: 29743-08-6, EBBA, p-Ethoxybenzylidene p-butylaniline, 4-Butyl-N-(4-ethoxybenzylidene)aniline, Benzenamine, 4-butyl-N-[(4-ethoxyphenyl)methylene].
What is the molecular weight of the compound?
The molecular weight of the compound is 281.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-(4-butylphenyl)-1-(4-ethoxyphenyl)methanimine.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C19H23NO/c1-3-5-6-16-7-11-18(12-8-16)20-15-17-9-13-19(14-10-17)21-4-2/h7-15H,3-6H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is DBOAVDSSZWDGTH-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCCCC1=CC=C(C=C1)N=CC2=CC=C(C=C2)OCC.
What is the CAS number of the compound?
The CAS number of the compound is 29743-08-6.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 249-821-8.
Does the compound have a defined bond stereocenter count?
No, the compound does not have a defined bond stereocenter count.