What is the molecular formula of 7-Bromo-4-fluoroindole?
The molecular formula is C8H5BrFN.
What is the molecular weight of 7-Bromo-4-fluoroindole?
The molecular weight is 214.03 g/mol.
What is the IUPAC name of 7-Bromo-4-fluoroindole?
The IUPAC name is 7-bromo-4-fluoro-1H-indole.
What is the InChI of 7-Bromo-4-fluoroindole?
The InChI is InChI=1S/C8H5BrFN/c9-6-1-2-7(10)5-3-4-11-8(5)6/h1-4,11H.
What is the InChIKey of 7-Bromo-4-fluoroindole?
The InChIKey is PRXUTIXCOBFMMM-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Bromo-4-fluoroindole?
The canonical SMILES is C1=CC(=C2C(=C1F)C=CN2)Br.
What is the XLogP3-AA value of 7-Bromo-4-fluoroindole?
The XLogP3-AA value is 2.8.
How many hydrogen bond donor count does 7-Bromo-4-fluoroindole have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does 7-Bromo-4-fluoroindole have?
It has 1 hydrogen bond acceptor count.
What is the topological polar surface area of 7-Bromo-4-fluoroindole?
The topological polar surface area is 15.8Ų.