What is the molecular formula of 2,3-Dibromo-5-picoline?
The molecular formula of 2,3-Dibromo-5-picoline is C6H5Br2N.
What is the molecular weight of 2,3-Dibromo-5-picoline?
The molecular weight of 2,3-Dibromo-5-picoline is 250.92 g/mol.
What is the IUPAC name of 2,3-Dibromo-5-picoline?
The IUPAC name of 2,3-Dibromo-5-picoline is 2,3-dibromo-5-methylpyridine.
What is the InChI of 2,3-Dibromo-5-picoline?
The InChI of 2,3-Dibromo-5-picoline is InChI=1S/C6H5Br2N/c1-4-2-5(7)6(8)9-3-4/h2-3H,1H3.
What is the InChIKey of 2,3-Dibromo-5-picoline?
The InChIKey of 2,3-Dibromo-5-picoline is BZUZAZMAGVFIBS-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Dibromo-5-picoline?
The canonical SMILES of 2,3-Dibromo-5-picoline is CC1=CC(=C(N=C1)Br)Br.
What is the CAS number of 2,3-Dibromo-5-picoline?
The CAS number of 2,3-Dibromo-5-picoline is 29232-39-1.
What is the European Community (EC) number of 2,3-Dibromo-5-picoline?
The European Community (EC) number of 2,3-Dibromo-5-picoline is 686-907-8.
What is the DSSTox Substance ID of 2,3-Dibromo-5-picoline?
The DSSTox Substance ID of 2,3-Dibromo-5-picoline is DTXSID10301313.
Is 2,3-Dibromo-5-picoline a canonicalized compound?
Yes, 2,3-Dibromo-5-picoline is a canonicalized compound.