The synonyms include 249561-98-6, 291756-76-8, N-(2-Chloro-3-(dimethylamino)allylidene)-N-methylmethanaminium hexafluorophosphate(V), and 2-Chloro-1,3-bis(dimentylamino)trimethinium hexafluorophosphate.
What is the IUPAC name of the compound?
The IUPAC name is [(Z)-2-chloro-3-(dimethylamino)prop-2-enylidene]-dimethylazanium;hexafluorophosphate.
What is the InChI of the compound?
The InChI is InChI=1S/C7H14ClN2.F6P/c1-9(2)5-7(8)6-10(3)4;1-7(2,3,4,5)6/h5-6H,1-4H3;/q+1;-1.
What is the InChIKey of the compound?
The InChIKey is PIUHAULDXSPPQV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is CN(C)C=C(C=[N+](C)C)Cl.F[P-](F)(F)(F)(F)F.
What is the CAS number of the compound?
The CAS number is 249561-98-6.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count is 8.
※ Please kindly note that our products are for research use only.