What is the molecular formula of N-Octylboronic acid?
The molecular formula of N-Octylboronic acid is C8H19BO2.
What is the molecular weight of N-Octylboronic acid?
The molecular weight of N-Octylboronic acid is 158.05 g/mol.
What is the IUPAC name of N-Octylboronic acid?
The IUPAC name of N-Octylboronic acid is octylboronic acid.
What is the InChI of N-Octylboronic acid?
The InChI of N-Octylboronic acid is InChI=1S/C8H19BO2/c1-2-3-4-5-6-7-8-9(10)11/h10-11H,2-8H2,1H3.
What is the InChIKey of N-Octylboronic acid?
The InChIKey of N-Octylboronic acid is GKFRVXOKPXCXAK-UHFFFAOYSA-N.
What is the canonical SMILES of N-Octylboronic acid?
The canonical SMILES of N-Octylboronic acid is B(CCCCCCCC)(O)O.
What is the CAS number of N-Octylboronic acid?
The CAS number of N-Octylboronic acid is 28741-08-4.
What is the European Community (EC) number of N-Octylboronic acid?
The European Community (EC) number of N-Octylboronic acid is 681-714-5.
What is the DSSTox Substance ID of N-Octylboronic acid?
The DSSTox Substance ID of N-Octylboronic acid is DTXSID10409368.
Is N-Octylboronic acid a canonicalized compound?
Yes, N-Octylboronic acid is a canonicalized compound.