Some synonyms for the compound are 286454-86-2, (S)-1-(Diphenylphosphino)-3,3-dimethylbutan-2-amine, and 2-Butanamine, 1-(diphenylphosphino)-3,3-dimethyl-, (2S)-.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2S)-1-diphenylphosphanyl-3,3-dimethylbutan-2-amine.
What is the molecular weight of the compound?
The molecular weight of the compound is 285.4 g/mol.
What is the InChI key of the compound?
The InChI key of the compound is SGBNMEAXYLJQRV-QGZVFWFLSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(C)(C)C(CP(C1=CC=CC=C1)C2=CC=CC=C2)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.9.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many rotatable bond counts does the compound have?
The compound has 5 rotatable bond counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 26Ų.
※ Please kindly note that our products are for research use only.