What is the PubChem CID of 1,2-Epoxycycloheptane?
The PubChem CID of 1,2-Epoxycycloheptane is 67512.
What is the molecular formula of 1,2-Epoxycycloheptane?
The molecular formula of 1,2-Epoxycycloheptane is C7H12O.
What is the molecular weight of 1,2-Epoxycycloheptane?
The molecular weight of 1,2-Epoxycycloheptane is 112.17 g/mol.
What is the IUPAC name of 1,2-Epoxycycloheptane?
The IUPAC name of 1,2-Epoxycycloheptane is 8-oxabicyclo[5.1.0]octane.
What is the InChI of 1,2-Epoxycycloheptane?
The InChI of 1,2-Epoxycycloheptane is InChI=1S/C7H12O/c1-2-4-6-7(8-6)5-3-1/h6-7H,1-5H2.
What is the InChIKey of 1,2-Epoxycycloheptane?
The InChIKey of 1,2-Epoxycycloheptane is MLOZFLXCWGERSM-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2-Epoxycycloheptane?
The canonical SMILES of 1,2-Epoxycycloheptane is C1CCC2C(O2)CC1.
What is the CAS number of 1,2-Epoxycycloheptane?
The CAS number of 1,2-Epoxycycloheptane is 286-45-3.
What is the European Community (EC) number of 1,2-Epoxycycloheptane?
The European Community (EC) number of 1,2-Epoxycycloheptane is 206-009-8.
Is 1,2-Epoxycycloheptane a canonicalized compound?
Yes, 1,2-Epoxycycloheptane is a canonicalized compound according to PubChem.