What is the chemical formula of diisodecyl azelate?
The chemical formula of diisodecyl azelate is C29H56O4.
What are the synonyms of diisodecyl azelate?
The synonyms of diisodecyl azelate are Nonanedioic acid, diisodecyl ester and Azelaic acid, diisodecyl ester.
What is the molecular weight of diisodecyl azelate?
The molecular weight of diisodecyl azelate is 468.8 g/mol.
When was diisodecyl azelate created?
Diisodecyl azelate was created on March 27, 2005.
What is the IUPAC name of diisodecyl azelate?
The IUPAC name of diisodecyl azelate is bis(8-methylnonyl) nonanedioate.
What is the InChI of diisodecyl azelate?
The InChI of diisodecyl azelate is InChI=1S/C29H56O4/c1-26(2)20-14-8-6-12-18-24-32-28(30)22-16-10-5-11-17-23-29(31)33-25-19-13-7-9-15-21-27(3)4/h26-27H,5-25H2,1-4H3.
What is the InChIKey of diisodecyl azelate?
The InChIKey of diisodecyl azelate is WLLCYXDFVBWGBU-UHFFFAOYSA-N.
What is the CAS number of diisodecyl azelate?
The CAS number of diisodecyl azelate is 28472-97-1.
What is the European Community (EC) number of diisodecyl azelate?
The European Community (EC) number of diisodecyl azelate is 249-044-4.
What is the physical description of diisodecyl azelate?
Diisodecyl azelate is a liquid.