What is the molecular formula of 7-Fluoro-1-tetralone?
The molecular formula of 7-Fluoro-1-tetralone is C10H9FO.
What is the molecular weight of 7-Fluoro-1-tetralone?
The molecular weight of 7-Fluoro-1-tetralone is 164.18 g/mol.
What is the IUPAC name of 7-Fluoro-1-tetralone?
The IUPAC name of 7-Fluoro-1-tetralone is 7-fluoro-3,4-dihydro-2H-naphthalen-1-one.
What is the InChI of 7-Fluoro-1-tetralone?
The InChI of 7-Fluoro-1-tetralone is InChI=1S/C10H9FO/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h4-6H,1-3H2.
What is the InChIKey of 7-Fluoro-1-tetralone?
The InChIKey of 7-Fluoro-1-tetralone is UCBYBFAJSWCTLG-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Fluoro-1-tetralone?
The canonical SMILES of 7-Fluoro-1-tetralone is C1CC2=C(C=C(C=C2)F)C(=O)C1.
What is the CAS number of 7-Fluoro-1-tetralone?
The CAS number of 7-Fluoro-1-tetralone is 2840-44-0.
What is the European Community (EC) number of 7-Fluoro-1-tetralone?
The European Community (EC) number of 7-Fluoro-1-tetralone is 687-278-2.
What is the XLogP3-AA value of 7-Fluoro-1-tetralone?
The XLogP3-AA value of 7-Fluoro-1-tetralone is 2.1.
Is 7-Fluoro-1-tetralone a canonicalized compound?
Yes, 7-Fluoro-1-tetralone is a canonicalized compound.