What is the molecular formula of 2,5-Dibromophenol?
The molecular formula of 2,5-Dibromophenol is C6H4Br2O.
What is the molecular weight of 2,5-Dibromophenol?
The molecular weight of 2,5-Dibromophenol is 251.90 g/mol.
What is the IUPAC Name of 2,5-Dibromophenol?
The IUPAC Name of 2,5-Dibromophenol is 2,5-dibromophenol.
What is the InChI of 2,5-Dibromophenol?
The InChI of 2,5-Dibromophenol is InChI=1S/C6H4Br2O/c7-4-1-2-5(8)6(9)3-4/h1-3,9H.
What is the InChIKey of 2,5-Dibromophenol?
The InChIKey of 2,5-Dibromophenol is GUXWVUVLXIJHQF-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dibromophenol?
The canonical SMILES of 2,5-Dibromophenol is C1=CC(=C(C=C1Br)O)Br.
What is the CAS number of 2,5-Dibromophenol?
The CAS number of 2,5-Dibromophenol is 28165-52-8.
What is the European Community (EC) Number of 2,5-Dibromophenol?
The European Community (EC) Number of 2,5-Dibromophenol is 631-119-1.
What is the DSSTox Substance ID of 2,5-Dibromophenol?
The DSSTox Substance ID of 2,5-Dibromophenol is DTXSID40182430.
Is 2,5-Dibromophenol a canonicalized compound?
Yes, 2,5-Dibromophenol is a canonicalized compound.