What is the molecular formula of Benzo[1,3,2]dioxaborole?
The molecular formula of Benzo[1,3,2]dioxaborole is C6H4BO2.
What is the molecular weight of Benzo[1,3,2]dioxaborole?
The molecular weight of Benzo[1,3,2]dioxaborole is 118.91 g/mol.
What is the InChI of Benzo[1,3,2]dioxaborole?
The InChI of Benzo[1,3,2]dioxaborole is InChI=1S/C6H4BO2/c1-2-4-6-5(3-1)8-7-9-6/h1-4H.
What is the InChIKey of Benzo[1,3,2]dioxaborole?
The InChIKey of Benzo[1,3,2]dioxaborole is ZDQWVKDDJDIVAL-UHFFFAOYSA-N.
What is the canonical SMILES of Benzo[1,3,2]dioxaborole?
The canonical SMILES of Benzo[1,3,2]dioxaborole is [B]1OC2=CC=CC=C2O1.
What is the CAS number of Benzo[1,3,2]dioxaborole?
The CAS number of Benzo[1,3,2]dioxaborole is 274-07-7.
What is the EC number of Benzo[1,3,2]dioxaborole?
The EC number of Benzo[1,3,2]dioxaborole is 205-991-5.
What is the UNII of Benzo[1,3,2]dioxaborole?
The UNII of Benzo[1,3,2]dioxaborole is UB69382H5J.
What is the DSSTox Substance ID of Benzo[1,3,2]dioxaborole?
The DSSTox Substance ID of Benzo[1,3,2]dioxaborole is DTXSID3059769.
What is the Wikipedia page of Benzo[1,3,2]dioxaborole?
The Wikipedia page of Benzo[1,3,2]dioxaborole is Catecholborane.