What is the molecular formula of 3-Aminofluoranthene?
The molecular formula of 3-Aminofluoranthene is C16H11N.
What is the molecular weight of 3-Aminofluoranthene?
The molecular weight of 3-Aminofluoranthene is 217.26 g/mol.
What is the IUPAC name of 3-Aminofluoranthene?
The IUPAC name of 3-Aminofluoranthene is fluoranthen-3-amine.
What is the InChI key of 3-Aminofluoranthene?
The InChI key of 3-Aminofluoranthene is VHGJAFIHUSTRGB-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Aminofluoranthene?
The Canonical SMILES of 3-Aminofluoranthene is C1=CC=C2C(=C1)C3=C4C2=CC=CC4=C(C=C3)N.
What is the CAS number of 3-Aminofluoranthene?
The CAS number of 3-Aminofluoranthene is 2693-46-1.
What is the XLogP3 value of 3-Aminofluoranthene?
The XLogP3 value of 3-Aminofluoranthene is 4.2.
How many hydrogen bond donor count does 3-Aminofluoranthene have?
3-Aminofluoranthene has 1 hydrogen bond donor count.
How many rotatable bond count does 3-Aminofluoranthene have?
3-Aminofluoranthene has 0 rotatable bond count.
Is 3-Aminofluoranthene a canonicalized compound?
Yes, 3-Aminofluoranthene is a canonicalized compound.