What is the molecular formula of Triisooctylamine?
The molecular formula of Triisooctylamine is C24H51N.
What are the synonyms of Triisooctylamine?
The synonyms of Triisooctylamine are Triisooctylamine, Tris(6-methylheptyl)amine, and 1-Heptanamine, 6-methyl-N,N-bis(6-methylheptyl).
What is the molecular weight of Triisooctylamine?
The molecular weight of Triisooctylamine is 353.7 g/mol.
What is the IUPAC name of Triisooctylamine?
The IUPAC name of Triisooctylamine is 6-methyl-N,N-bis(6-methylheptyl)heptan-1-amine.
What is the InChI of Triisooctylamine?
The InChI of Triisooctylamine is InChI=1S/C24H51N/c1-22(2)16-10-7-13-19-25(20-14-8-11-17-23(3)4)21-15-9-12-18-24(5)6/h22-24H,7-21H2,1-6H3.
What is the InChIKey of Triisooctylamine?
The InChIKey of Triisooctylamine is YKGBNAGNNUEZQC-UHFFFAOYSA-N.
What is the canonical SMILES of Triisooctylamine?
The canonical SMILES of Triisooctylamine is CC(C)CCCCCN(CCCCCC(C)C)CCCCCC(C)C.
What is the CAS number of Triisooctylamine?
The CAS number of Triisooctylamine is 2757-28-0.
What is the XLogP3-AA value of Triisooctylamine?
The XLogP3-AA value of Triisooctylamine is 9.6.