What is the molecular formula of 2-Iodofluorene?
The molecular formula of 2-Iodofluorene is C13H9I.
What is the molecular weight of 2-Iodofluorene?
The molecular weight of 2-Iodofluorene is 292.11 g/mol.
What is the IUPAC name of 2-Iodofluorene?
The IUPAC name of 2-Iodofluorene is 2-iodo-9H-fluorene.
What is the InChI of 2-Iodofluorene?
The InChI of 2-Iodofluorene is InChI=1S/C13H9I/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2.
What is the InChIKey of 2-Iodofluorene?
The InChIKey of 2-Iodofluorene is VNYQUOAQPXGXQO-UHFFFAOYSA-N.
What is the CAS number of 2-Iodofluorene?
The CAS number of 2-Iodofluorene is 2523-42-4.
What is the European Community (EC) number of 2-Iodofluorene?
The European Community (EC) number of 2-Iodofluorene is 627-435-4.
What is the DSSTox Substance ID of 2-Iodofluorene?
The DSSTox Substance ID of 2-Iodofluorene is DTXSID40279334.
What is the Wikidata ID of 2-Iodofluorene?
The Wikidata ID of 2-Iodofluorene is Q72483623.
What is the XLogP3 value of 2-Iodofluorene?
The XLogP3 value of 2-Iodofluorene is 4.8.