What is the molecular formula of calcium oxalate hydrate?
The molecular formula of calcium oxalate hydrate is C2H2CaO5.
What is the molecular weight of calcium oxalate hydrate?
The molecular weight of calcium oxalate hydrate is 146.11 g/mol.
What is the IUPAC name of calcium oxalate hydrate?
The IUPAC name of calcium oxalate hydrate is calcium;oxalate;hydrate.
What is the InChI of calcium oxalate hydrate?
The InChI of calcium oxalate hydrate is InChI=1S/C2H2O4.Ca.H2O/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;1H2/q;+2;/p-2.
What is the canonical SMILES of calcium oxalate hydrate?
The canonical SMILES of calcium oxalate hydrate is C(=O)(C(=O)[O-])[O-].O.[Ca+2].
What is the CAS number of calcium oxalate hydrate?
The CAS number of calcium oxalate hydrate is 118175-19-2.
How many hydrogen bond donor counts does calcium oxalate hydrate have?
Calcium oxalate hydrate has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does calcium oxalate hydrate have?
Calcium oxalate hydrate has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of calcium oxalate hydrate?
The topological polar surface area of calcium oxalate hydrate is 81.3Ų.
How many covalently-bonded unit counts does calcium oxalate hydrate have?
Calcium oxalate hydrate has 3 covalently-bonded unit counts.