What is the PubChem CID of 2,5-Dimethoxytoluene?
The PubChem CID of 2,5-Dimethoxytoluene is 90552.
What is the molecular formula of 2,5-Dimethoxytoluene?
The molecular formula of 2,5-Dimethoxytoluene is C9H12O2.
What are the synonyms of 2,5-Dimethoxytoluene?
The synonyms of 2,5-Dimethoxytoluene are 24599-58-4, 1,4-Dimethoxy-2-methylbenzene, Benzene, 1,4-dimethoxy-2-methyl-, Toluene, 2,5-dimethoxy-, and more.
What is the molecular weight of 2,5-Dimethoxytoluene?
The molecular weight of 2,5-Dimethoxytoluene is 152.19 g/mol.
What is the IUPAC name of 2,5-Dimethoxytoluene?
The IUPAC name of 2,5-Dimethoxytoluene is 1,4-dimethoxy-2-methylbenzene.
What is the InChI of 2,5-Dimethoxytoluene?
The InChI of 2,5-Dimethoxytoluene is InChI=1S/C9H12O2/c1-7-6-8(10-2)4-5-9(7)11-3/h4-6H,1-3H3.
What is the InChIKey of 2,5-Dimethoxytoluene?
The InChIKey of 2,5-Dimethoxytoluene is IQISOVKPFBLQIQ-UHFFFAOYSA-N.
What is the CAS number of 2,5-Dimethoxytoluene?
The CAS number of 2,5-Dimethoxytoluene is 24599-58-4.
What is the UNII of 2,5-Dimethoxytoluene?
The UNII of 2,5-Dimethoxytoluene is QK260AXY6T.
Is 2,5-Dimethoxytoluene a canonicalized compound?
Yes, 2,5-Dimethoxytoluene is a canonicalized compound.