What is the molecular formula of H-PHE-TRP-OH?
The molecular formula of H-PHE-TRP-OH is C20H21N3O3.
What are the synonyms of H-PHE-TRP-OH?
The synonyms of H-PHE-TRP-OH are Phenylalanyltryptophan, 24587-41-5, Phe-Trp, and L-phenylalanyl-L-tryptophan.
What is the molecular weight of H-PHE-TRP-OH?
The molecular weight of H-PHE-TRP-OH is 351.4 g/mol.
When was H-PHE-TRP-OH created?
H-PHE-TRP-OH was created on August 8, 2005.
What is the role of H-PHE-TRP-OH?
H-PHE-TRP-OH has a role as a metabolite.
What is the IUPAC name of H-PHE-TRP-OH?
The IUPAC name of H-PHE-TRP-OH is (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
What is the InChI of H-PHE-TRP-OH?
The InChI of H-PHE-TRP-OH is InChI=1S/C20H21N3O3/c21-16(10-13-6-2-1-3-7-13)19(24)23-18(20(25)26)11-14-12-22-17-9-5-4-8-15(14)17/h1-9,12,16,18,22H,10-11,21H2,(H,23,24)(H,25,26)/t16-,18-/m0/s1.
What is the InChIKey of H-PHE-TRP-OH?
The InChIKey of H-PHE-TRP-OH is JMCOUWKXLXDERB-WMZOPIPTSA-N.
What is the canonical SMILES of H-PHE-TRP-OH?
The canonical SMILES of H-PHE-TRP-OH is C1=CC=C(C=C1)CC(C(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)O)N.
What is the CAS number of H-PHE-TRP-OH?
The CAS number of H-PHE-TRP-OH is 24587-41-5.