What is the molecular formula of 5H-Pyrido[3,2-b]indole?
The molecular formula is C11H8N2.
What are the synonyms of 5H-Pyrido[3,2-b]indole?
The synonyms are delta-Carboline and 5H-Pyrido(3,2-b)indole.
What is the molecular weight of 5H-Pyrido[3,2-b]indole?
The molecular weight is 168.19 g/mol.
What is the IUPAC name of 5H-Pyrido[3,2-b]indole?
The IUPAC name is 5H-pyrido[3,2-b]indole.
What is the InChI of 5H-Pyrido[3,2-b]indole?
The InChI is InChI=1S/C11H8N2/c1-2-5-9-8(4-1)11-10(13-9)6-3-7-12-11/h1-7,13H.
What is the InChIKey of 5H-Pyrido[3,2-b]indole?
The InChIKey is NSBVOLBUJPCPFH-UHFFFAOYSA-N.
What is the canonical SMILES of 5H-Pyrido[3,2-b]indole?
The canonical SMILES is C1=CC=C2C(=C1)C3=C(N2)C=CC=N3.
What is the CAS number of 5H-Pyrido[3,2-b]indole?
The CAS number is 245-08-9.
What is the XLogP3-AA value of 5H-Pyrido[3,2-b]indole?
The XLogP3-AA value is 2.4.
Is 5H-Pyrido[3,2-b]indole canonicalized?
Yes, 5H-Pyrido[3,2-b]indole is canonicalized.