What is the molecular formula of Ethyl 3-bromobenzoate?
The molecular formula of Ethyl 3-bromobenzoate is C9H9BrO2.
What are the synonyms for Ethyl 3-bromobenzoate?
Some synonyms for Ethyl 3-bromobenzoate are Benzoic acid, 3-bromo-, ethyl ester and 3-Bromobenzoic Acid Ethyl Ester.
What is the molecular weight of Ethyl 3-bromobenzoate?
The molecular weight of Ethyl 3-bromobenzoate is 229.07 g/mol.
What is the IUPAC name of Ethyl 3-bromobenzoate?
The IUPAC name of Ethyl 3-bromobenzoate is ethyl 3-bromobenzoate.
What is the InChI of Ethyl 3-bromobenzoate?
The InChI of Ethyl 3-bromobenzoate is InChI=1S/C9H9BrO2/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3.
What is the InChIKey of Ethyl 3-bromobenzoate?
The InChIKey of Ethyl 3-bromobenzoate is QAUASTLEZAPQTB-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 3-bromobenzoate?
The canonical SMILES of Ethyl 3-bromobenzoate is CCOC(=O)C1=CC(=CC=C1)Br.
What is the CAS number of Ethyl 3-bromobenzoate?
The CAS number of Ethyl 3-bromobenzoate is 24398-88-7.
What is the European Community (EC) number of Ethyl 3-bromobenzoate?
The European Community (EC) number of Ethyl 3-bromobenzoate is 246-223-9.
Is Ethyl 3-bromobenzoate a canonicalized compound?
Yes, Ethyl 3-bromobenzoate is a canonicalized compound according to PubChem.