What is the CAS number for Tri(2-thienyl)phosphine oxide?
The CAS number for Tri(2-thienyl)phosphine oxide is 1021-21-2.
What is the molecular formula of Tri(2-thienyl)phosphine oxide?
The molecular formula of Tri(2-thienyl)phosphine oxide is C12H9OPS3.
What is the molecular weight of Tri(2-thienyl)phosphine oxide?
The molecular weight of Tri(2-thienyl)phosphine oxide is 296.4 g/mol.
What is the Exact Mass of Tri(2-thienyl)phosphine oxide?
The Exact Mass of Tri(2-thienyl)phosphine oxide is 295.95531542.
What is the Canonical SMILES representation of Tri(2-thienyl)phosphine oxide?
The Canonical SMILES representation of Tri(2-thienyl)phosphine oxide is C1=CSC(=C1)P(=O)(C2=CC=CS2)C3=CC=CS3.
How many hydrogen bond acceptors are present in the computed properties of Tri(2-thienyl)phosphine oxide?
There are 4 hydrogen bond acceptors present in the computed properties of Tri(2-thienyl)phosphine oxide.
What is the InChIKey for Tri(2-thienyl)phosphine oxide?
The InChIKey for Tri(2-thienyl)phosphine oxide is OKBJXDNWMXROFT-UHFFFAOYSA-N.
What are some synonyms for Tri(2-thienyl)phosphine oxide?
Some synonyms for Tri(2-thienyl)phosphine oxide are Tri(thiophen-2-yl)phosphine oxide, 2-dithiophen-2-ylphosphorylthiophene, and NSC400344.
How many heavy atoms are present in Tri(2-thienyl)phosphine oxide?
There are 17 heavy atoms present in Tri(2-thienyl)phosphine oxide.